C16H14FNO2 — CID 81325820
4-[3-fluoro-5-(pyridin-3-ylmethoxy)phenyl]but-3-yn-1-ol (PubChem CID 81325820) has the molecular formula C16H14FNO2 and a molecular weight of 271.29 g/mol. Its IUPAC name is 4-[3-fluoro-5-(pyridin-3-ylmethoxy)phenyl]but-3-yn-1-ol.
| Compound Name | 4-[3-fluoro-5-(pyridin-3-ylmethoxy)phenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 81325820 |
| Molecular Formula | C16H14FNO2 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 4-[3-fluoro-5-(pyridin-3-ylmethoxy)phenyl]but-3-yn-1-ol |
| SMILES | OCCC#Cc1cc(F)cc(OCc2cccnc2)c1 |
| InChI | InChI=1S/C16H14FNO2/c17-15-8-13(4-1-2-7-19)9-16(10-15)20-12-14-5-3-6-18-11-14/h3,5-6,8-11,19H,2,7,12H2 |
| InChIKey | JYBFIJLOEIFPGM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|