C11H13BFN3O3 — CID 81331669
[3-[(2-ethyl-1,2,4-triazol-3-yl)methoxy]-5-fluorophenyl]boronic acid (PubChem CID 81331669) has the molecular formula C11H13BFN3O3 and a molecular weight of 265.05 g/mol. Its IUPAC name is [3-[(2-ethyl-1,2,4-triazol-3-yl)methoxy]-5-fluorophenyl]boronic acid.
| Compound Name | [3-[(2-ethyl-1,2,4-triazol-3-yl)methoxy]-5-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 81331669 |
| Molecular Formula | C11H13BFN3O3 |
| Molecular Weight | 265.05 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | [3-[(2-ethyl-1,2,4-triazol-3-yl)methoxy]-5-fluorophenyl]boronic acid |
| SMILES | CCn1ncnc1COc1cc(F)cc(B(O)O)c1 |
| InChI | InChI=1S/C11H13BFN3O3/c1-2-16-11(14-7-15-16)6-19-10-4-8(12(17)18)3-9(13)5-10/h3-5,7,17-18H,2,6H2,1H3 |
| InChIKey | XUGIUFBVCOGRMH-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.05 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|