About (6S)-N-[(5-chlorothiophen-2-yl)methyl]-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-amine
(6S)-N-[(5-chlorothiophen-2-yl)methyl]-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-amine (PubChem CID 81332614) has the molecular formula C13H14ClNS3
and a molecular weight of 315.92 g/mol. Its IUPAC name is (6S)-N-[(5-chlorothiophen-2-yl)methyl]-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-amine.
Molecular Properties
| Compound Name | (6S)-N-[(5-chlorothiophen-2-yl)methyl]-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-amine |
| PubChem CID | 81332614 |
| Molecular Formula | C13H14ClNS3 |
| Molecular Weight | 315.92 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | (6S)-N-[(5-chlorothiophen-2-yl)methyl]-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-amine |
| SMILES | C[C@H]1CC(NCc2ccc(Cl)s2)c2ccsc2S1 |
| InChI | InChI=1S/C13H14ClNS3/c1-8-6-11(10-4-5-16-13(10)17-8)15-7-9-2-3-12(14)18-9/h2-5,8,11,15H,6-7H2,1H3/t8-,11?/m0/s1 |
| InChIKey | WSHVUBDAFPKDQU-YMNIQAILSA-N |
| XLogP | 5.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 315.92 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6S)-N-[(5-chlorothiophen-2-yl)methyl]-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-N-[(5-chlorothiophen-2-yl)methyl]-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-amine?
The IUPAC name of (6S)-N-[(5-chlorothiophen-2-yl)methyl]-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-amine (CID 81332614) is (6S)-N-[(5-chlorothiophen-2-yl)methyl]-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-amine.
What is the SMILES notation for (6S)-N-[(5-chlorothiophen-2-yl)methyl]-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-amine?
The canonical SMILES for (6S)-N-[(5-chlorothiophen-2-yl)methyl]-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-amine is C[C@H]1CC(NCc2ccc(Cl)s2)c2ccsc2S1.
What is the InChIKey of (6S)-N-[(5-chlorothiophen-2-yl)methyl]-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-amine?
The InChIKey is WSHVUBDAFPKDQU-YMNIQAILSA-N. The full InChI is InChI=1S/C13H14ClNS3/c1-8-6-11(10-4-5-16-13(10)17-8)15-7-9-2-3-12(14)18-9/h2-5,8,11,15H,6-7H2,1H3/t8-,11?/m0/s1.
What are the key properties of (6S)-N-[(5-chlorothiophen-2-yl)methyl]-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-amine?
(6S)-N-[(5-chlorothiophen-2-yl)methyl]-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-amine has a molecular weight of 315.92 g/mol, XLogP of 5.18, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-N-[(5-chlorothiophen-2-yl)methyl]-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-4-amine is sourced from PubChem (CID 81332614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).