C14H20FNOS — CID 81334277
[2-(3-fluorophenyl)sulfinyl-4-methylcyclohexyl]methanamine (PubChem CID 81334277) has the molecular formula C14H20FNOS and a molecular weight of 269.38 g/mol. Its IUPAC name is [2-(3-fluorophenyl)sulfinyl-4-methylcyclohexyl]methanamine.
| Compound Name | [2-(3-fluorophenyl)sulfinyl-4-methylcyclohexyl]methanamine |
|---|---|
| PubChem CID | 81334277 |
| Molecular Formula | C14H20FNOS |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | [2-(3-fluorophenyl)sulfinyl-4-methylcyclohexyl]methanamine |
| SMILES | CC1CCC(CN)C(S(=O)c2cccc(F)c2)C1 |
| InChI | InChI=1S/C14H20FNOS/c1-10-5-6-11(9-16)14(7-10)18(17)13-4-2-3-12(15)8-13/h2-4,8,10-11,14H,5-7,9,16H2,1H3 |
| InChIKey | QOAFJVKJMWIEKE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |