C14H19F2NOS — CID 81328856
[2-(2,4-difluorophenyl)sulfinyl-4-methylcyclohexyl]methanamine (PubChem CID 81328856) has the molecular formula C14H19F2NOS and a molecular weight of 287.37 g/mol. Its IUPAC name is [2-(2,4-difluorophenyl)sulfinyl-4-methylcyclohexyl]methanamine.
| Compound Name | [2-(2,4-difluorophenyl)sulfinyl-4-methylcyclohexyl]methanamine |
|---|---|
| PubChem CID | 81328856 |
| Molecular Formula | C14H19F2NOS |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | [2-(2,4-difluorophenyl)sulfinyl-4-methylcyclohexyl]methanamine |
| SMILES | CC1CCC(CN)C(S(=O)c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C14H19F2NOS/c1-9-2-3-10(8-17)14(6-9)19(18)13-5-4-11(15)7-12(13)16/h4-5,7,9-10,14H,2-3,6,8,17H2,1H3 |
| InChIKey | LLGIXBFNBLMDPA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |