C10H18N2S — CID 81334521
3-(2,3-dimethylbutyl)-4-methyl-1H-imidazole-2-thione (PubChem CID 81334521) has the molecular formula C10H18N2S and a molecular weight of 198.33 g/mol. Its IUPAC name is 3-(2,3-dimethylbutyl)-4-methyl-1H-imidazole-2-thione.
| Compound Name | 3-(2,3-dimethylbutyl)-4-methyl-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 81334521 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 3-(2,3-dimethylbutyl)-4-methyl-1H-imidazole-2-thione |
| SMILES | Cc1c[nH]c(=S)n1CC(C)C(C)C |
| InChI | InChI=1S/C10H18N2S/c1-7(2)8(3)6-12-9(4)5-11-10(12)13/h5,7-8H,6H2,1-4H3,(H,11,13) |
| InChIKey | PQHZGUFHSYWUSQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|