C14H24N2S — CID 81334530
4-tert-butyl-3-(2,2,3,3-tetramethylcyclopropyl)-1H-imidazole-2-thione (PubChem CID 81334530) has the molecular formula C14H24N2S and a molecular weight of 252.43 g/mol. Its IUPAC name is 4-tert-butyl-3-(2,2,3,3-tetramethylcyclopropyl)-1H-imidazole-2-thione.
| Compound Name | 4-tert-butyl-3-(2,2,3,3-tetramethylcyclopropyl)-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 81334530 |
| Molecular Formula | C14H24N2S |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 4-tert-butyl-3-(2,2,3,3-tetramethylcyclopropyl)-1H-imidazole-2-thione |
| SMILES | CC(C)(C)c1c[nH]c(=S)n1C1C(C)(C)C1(C)C |
| InChI | InChI=1S/C14H24N2S/c1-12(2,3)9-8-15-11(17)16(9)10-13(4,5)14(10,6)7/h8,10H,1-7H3,(H,15,17) |
| InChIKey | JREARXCIKDGLIO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|