C14H26N2S — CID 64864136
4-propan-2-yl-3-(2,4,4-trimethylpentan-2-yl)-1H-imidazole-2-thione (PubChem CID 64864136) has the molecular formula C14H26N2S and a molecular weight of 254.44 g/mol. Its IUPAC name is 4-propan-2-yl-3-(2,4,4-trimethylpentan-2-yl)-1H-imidazole-2-thione.
| Compound Name | 4-propan-2-yl-3-(2,4,4-trimethylpentan-2-yl)-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 64864136 |
| Molecular Formula | C14H26N2S |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 4-propan-2-yl-3-(2,4,4-trimethylpentan-2-yl)-1H-imidazole-2-thione |
| SMILES | CC(C)c1c[nH]c(=S)n1C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C14H26N2S/c1-10(2)11-8-15-12(17)16(11)14(6,7)9-13(3,4)5/h8,10H,9H2,1-7H3,(H,15,17) |
| InChIKey | IVRSMRGIAVCBKQ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|