C11H8ClF3N2S — CID 81335715
3-[2-chloro-5-(trifluoromethyl)phenyl]-5-methyl-1H-imidazole-2-thione (PubChem CID 81335715) has the molecular formula C11H8ClF3N2S and a molecular weight of 292.71 g/mol. Its IUPAC name is 3-[2-chloro-5-(trifluoromethyl)phenyl]-5-methyl-1H-imidazole-2-thione.
| Compound Name | 3-[2-chloro-5-(trifluoromethyl)phenyl]-5-methyl-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 81335715 |
| Molecular Formula | C11H8ClF3N2S |
| Molecular Weight | 292.71 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | 3-[2-chloro-5-(trifluoromethyl)phenyl]-5-methyl-1H-imidazole-2-thione |
| SMILES | Cc1cn(-c2cc(C(F)(F)F)ccc2Cl)c(=S)[nH]1 |
| InChI | InChI=1S/C11H8ClF3N2S/c1-6-5-17(10(18)16-6)9-4-7(11(13,14)15)2-3-8(9)12/h2-5H,1H3,(H,16,18) |
| InChIKey | KETKECKITWNBQP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.71 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|