C9H7ClF3NO2S — CID 81340389
(E)-3-(5-chlorothiophen-2-yl)-N-(2,2,2-trifluoroethoxy)prop-2-enamide (PubChem CID 81340389) has the molecular formula C9H7ClF3NO2S and a molecular weight of 285.67 g/mol. Its IUPAC name is (E)-3-(5-chlorothiophen-2-yl)-N-(2,2,2-trifluoroethoxy)prop-2-enamide.
| Compound Name | (E)-3-(5-chlorothiophen-2-yl)-N-(2,2,2-trifluoroethoxy)prop-2-enamide |
|---|---|
| PubChem CID | 81340389 |
| Molecular Formula | C9H7ClF3NO2S |
| Molecular Weight | 285.67 g/mol |
| Exact Mass | 284.98 |
| IUPAC Name | (E)-3-(5-chlorothiophen-2-yl)-N-(2,2,2-trifluoroethoxy)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)s1)NOCC(F)(F)F |
| InChI | InChI=1S/C9H7ClF3NO2S/c10-7-3-1-6(17-7)2-4-8(15)14-16-5-9(11,12)13/h1-4H,5H2,(H,14,15)/b4-2+ |
| InChIKey | XGYVAKKRXYQAFD-DUXPYHPUSA-N |
| XLogP | 3.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.67 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|