C9H15N3O2S — CID 81340861
1-(2-cyclopropylethyl)-2-methylimidazole-4-sulfonamide (PubChem CID 81340861) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is 1-(2-cyclopropylethyl)-2-methylimidazole-4-sulfonamide.
| Compound Name | 1-(2-cyclopropylethyl)-2-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 81340861 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 1-(2-cyclopropylethyl)-2-methylimidazole-4-sulfonamide |
| SMILES | Cc1nc(S(N)(=O)=O)cn1CCC1CC1 |
| InChI | InChI=1S/C9H15N3O2S/c1-7-11-9(15(10,13)14)6-12(7)5-4-8-2-3-8/h6,8H,2-5H2,1H3,(H2,10,13,14) |
| InChIKey | GFKHYZXTQREQOX-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |