C10H11ClN4O — CID 81342055
[5-chloro-6-[(5-methyl-1H-pyrazol-3-yl)oxy]-3-pyridinyl]methanamine (PubChem CID 81342055) has the molecular formula C10H11ClN4O and a molecular weight of 238.68 g/mol. Its IUPAC name is [5-chloro-6-[(5-methyl-1H-pyrazol-3-yl)oxy]-3-pyridinyl]methanamine.
| Compound Name | [5-chloro-6-[(5-methyl-1H-pyrazol-3-yl)oxy]-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 81342055 |
| Molecular Formula | C10H11ClN4O |
| Molecular Weight | 238.68 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | [5-chloro-6-[(5-methyl-1H-pyrazol-3-yl)oxy]-3-pyridinyl]methanamine |
| SMILES | Cc1cc(Oc2ncc(CN)cc2Cl)n[nH]1 |
| InChI | InChI=1S/C10H11ClN4O/c1-6-2-9(15-14-6)16-10-8(11)3-7(4-12)5-13-10/h2-3,5H,4,12H2,1H3,(H,14,15) |
| InChIKey | SLJYPMUPHDGMDS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.68 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |