C12H9Cl3N2O — CID 62296562
[5-chloro-6-(2,5-dichlorophenoxy)-3-pyridinyl]methanamine (PubChem CID 62296562) has the molecular formula C12H9Cl3N2O and a molecular weight of 303.58 g/mol. Its IUPAC name is [5-chloro-6-(2,5-dichlorophenoxy)-3-pyridinyl]methanamine.
| Compound Name | [5-chloro-6-(2,5-dichlorophenoxy)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 62296562 |
| Molecular Formula | C12H9Cl3N2O |
| Molecular Weight | 303.58 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | [5-chloro-6-(2,5-dichlorophenoxy)-3-pyridinyl]methanamine |
| SMILES | NCc1cnc(Oc2cc(Cl)ccc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H9Cl3N2O/c13-8-1-2-9(14)11(4-8)18-12-10(15)3-7(5-16)6-17-12/h1-4,6H,5,16H2 |
| InChIKey | XJWMFIYKHWYGPW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |