C10H15F3N2O3 — CID 81343790
5-oxo-1-propan-2-yl-N-(2,2,2-trifluoroethoxy)pyrrolidine-3-carboxamide (PubChem CID 81343790) has the molecular formula C10H15F3N2O3 and a molecular weight of 268.24 g/mol. Its IUPAC name is 5-oxo-1-propan-2-yl-N-(2,2,2-trifluoroethoxy)pyrrolidine-3-carboxamide.
| Compound Name | 5-oxo-1-propan-2-yl-N-(2,2,2-trifluoroethoxy)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 81343790 |
| Molecular Formula | C10H15F3N2O3 |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 5-oxo-1-propan-2-yl-N-(2,2,2-trifluoroethoxy)pyrrolidine-3-carboxamide |
| SMILES | CC(C)N1CC(C(=O)NOCC(F)(F)F)CC1=O |
| InChI | InChI=1S/C10H15F3N2O3/c1-6(2)15-4-7(3-8(15)16)9(17)14-18-5-10(11,12)13/h6-7H,3-5H2,1-2H3,(H,14,17) |
| InChIKey | LWQKSLLNZXIWGD-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|