C16H25NO3 — CID 81344758
ethyl (3S)-1-(bicyclo[2.2.1]heptane-2-carbonyl)piperidine-3-carboxylate (PubChem CID 81344758) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is ethyl (3S)-1-(bicyclo[2.2.1]heptane-2-carbonyl)piperidine-3-carboxylate.
| Compound Name | ethyl (3S)-1-(bicyclo[2.2.1]heptane-2-carbonyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 81344758 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | ethyl (3S)-1-(bicyclo[2.2.1]heptane-2-carbonyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN(C(=O)C2CC3CCC2C3)C1 |
| InChI | InChI=1S/C16H25NO3/c1-2-20-16(19)13-4-3-7-17(10-13)15(18)14-9-11-5-6-12(14)8-11/h11-14H,2-10H2,1H3/t11?,12?,13-,14?/m0/s1 |
| InChIKey | NIVCOPYTSZDYQN-RFPFOJJUSA-N |
| XLogP | 2.22 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |