C10H19BrN2 — CID 81345297
N-(2-bromoprop-2-enyl)-1,2-dimethylpiperidin-4-amine (PubChem CID 81345297) has the molecular formula C10H19BrN2 and a molecular weight of 247.18 g/mol. Its IUPAC name is N-(2-bromoprop-2-enyl)-1,2-dimethylpiperidin-4-amine.
| Compound Name | N-(2-bromoprop-2-enyl)-1,2-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 81345297 |
| Molecular Formula | C10H19BrN2 |
| Molecular Weight | 247.18 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | N-(2-bromoprop-2-enyl)-1,2-dimethylpiperidin-4-amine |
| SMILES | C=C(Br)CNC1CCN(C)C(C)C1 |
| InChI | InChI=1S/C10H19BrN2/c1-8(11)7-12-10-4-5-13(3)9(2)6-10/h9-10,12H,1,4-7H2,2-3H3 |
| InChIKey | HQJABMYIWBVPNJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.18 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |