C18H19ClN2 — CID 81346935
(1R)-N-[(3-chloro-1H-indol-2-yl)methyl]-1-(4-methylphenyl)ethanamine (PubChem CID 81346935) has the molecular formula C18H19ClN2 and a molecular weight of 298.82 g/mol. Its IUPAC name is (1R)-N-[(3-chloro-1H-indol-2-yl)methyl]-1-(4-methylphenyl)ethanamine.
| Compound Name | (1R)-N-[(3-chloro-1H-indol-2-yl)methyl]-1-(4-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 81346935 |
| Molecular Formula | C18H19ClN2 |
| Molecular Weight | 298.82 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (1R)-N-[(3-chloro-1H-indol-2-yl)methyl]-1-(4-methylphenyl)ethanamine |
| SMILES | Cc1ccc([C@@H](C)NCc2[nH]c3ccccc3c2Cl)cc1 |
| InChI | InChI=1S/C18H19ClN2/c1-12-7-9-14(10-8-12)13(2)20-11-17-18(19)15-5-3-4-6-16(15)21-17/h3-10,13,20-21H,11H2,1-2H3/t13-/m1/s1 |
| InChIKey | ISTGHEWVJHFFQF-CYBMUJFWSA-N |
| XLogP | 4.98 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.82 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |