About N-[(3-chloro-1H-indol-2-yl)methyl]-2,2-difluoroethanamine
N-[(3-chloro-1H-indol-2-yl)methyl]-2,2-difluoroethanamine (PubChem CID 115406062) has the molecular formula C11H11ClF2N2
and a molecular weight of 244.67 g/mol. Its IUPAC name is N-[(3-chloro-1H-indol-2-yl)methyl]-2,2-difluoroethanamine.
Molecular Properties
| Compound Name | N-[(3-chloro-1H-indol-2-yl)methyl]-2,2-difluoroethanamine |
| PubChem CID | 115406062 |
| Molecular Formula | C11H11ClF2N2 |
| Molecular Weight | 244.67 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | N-[(3-chloro-1H-indol-2-yl)methyl]-2,2-difluoroethanamine |
| SMILES | FC(F)CNCc1[nH]c2ccccc2c1Cl |
| InChI | InChI=1S/C11H11ClF2N2/c12-11-7-3-1-2-4-8(7)16-9(11)5-15-6-10(13)14/h1-4,10,15-16H,5-6H2 |
| InChIKey | ATJJRJNDCDQBEL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.67 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(3-chloro-1H-indol-2-yl)methyl]-2,2-difluoroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-chloro-1H-indol-2-yl)methyl]-2,2-difluoroethanamine?
The IUPAC name of N-[(3-chloro-1H-indol-2-yl)methyl]-2,2-difluoroethanamine (CID 115406062) is N-[(3-chloro-1H-indol-2-yl)methyl]-2,2-difluoroethanamine.
What is the SMILES notation for N-[(3-chloro-1H-indol-2-yl)methyl]-2,2-difluoroethanamine?
The canonical SMILES for N-[(3-chloro-1H-indol-2-yl)methyl]-2,2-difluoroethanamine is FC(F)CNCc1[nH]c2ccccc2c1Cl.
What is the InChIKey of N-[(3-chloro-1H-indol-2-yl)methyl]-2,2-difluoroethanamine?
The InChIKey is ATJJRJNDCDQBEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClF2N2/c12-11-7-3-1-2-4-8(7)16-9(11)5-15-6-10(13)14/h1-4,10,15-16H,5-6H2.
What are the key properties of N-[(3-chloro-1H-indol-2-yl)methyl]-2,2-difluoroethanamine?
N-[(3-chloro-1H-indol-2-yl)methyl]-2,2-difluoroethanamine has a molecular weight of 244.67 g/mol, XLogP of 3.18, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-chloro-1H-indol-2-yl)methyl]-2,2-difluoroethanamine is sourced from PubChem (CID 115406062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).