C11H11ClF2N2 — CID 115406062
N-[(3-chloro-1H-indol-2-yl)methyl]-2,2-difluoroethanamine (PubChem CID 115406062) has the molecular formula C11H11ClF2N2 and a molecular weight of 244.67 g/mol. Its IUPAC name is N-[(3-chloro-1H-indol-2-yl)methyl]-2,2-difluoroethanamine.
| Compound Name | N-[(3-chloro-1H-indol-2-yl)methyl]-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 115406062 |
| Molecular Formula | C11H11ClF2N2 |
| Molecular Weight | 244.67 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | N-[(3-chloro-1H-indol-2-yl)methyl]-2,2-difluoroethanamine |
| SMILES | FC(F)CNCc1[nH]c2ccccc2c1Cl |
| InChI | InChI=1S/C11H11ClF2N2/c12-11-7-3-1-2-4-8(7)16-9(11)5-15-6-10(13)14/h1-4,10,15-16H,5-6H2 |
| InChIKey | ATJJRJNDCDQBEL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.67 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |