C13H16ClN3O2 — CID 106235822
2-[2-[(3-chloro-1H-indol-2-yl)methylamino]ethoxy]acetamide (PubChem CID 106235822) has the molecular formula C13H16ClN3O2 and a molecular weight of 281.74 g/mol. Its IUPAC name is 2-[2-[(3-chloro-1H-indol-2-yl)methylamino]ethoxy]acetamide.
| Compound Name | 2-[2-[(3-chloro-1H-indol-2-yl)methylamino]ethoxy]acetamide |
|---|---|
| PubChem CID | 106235822 |
| Molecular Formula | C13H16ClN3O2 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 2-[2-[(3-chloro-1H-indol-2-yl)methylamino]ethoxy]acetamide |
| SMILES | NC(=O)COCCNCc1[nH]c2ccccc2c1Cl |
| InChI | InChI=1S/C13H16ClN3O2/c14-13-9-3-1-2-4-10(9)17-11(13)7-16-5-6-19-8-12(15)18/h1-4,16-17H,5-8H2,(H2,15,18) |
| InChIKey | CCQKPJZWRVVPHW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|