C17H24ClN3O2 — CID 107245125
tert-butyl N-[2-[(3-chloro-1H-indol-2-yl)methylamino]ethyl]-N-methylcarbamate (PubChem CID 107245125) has the molecular formula C17H24ClN3O2 and a molecular weight of 337.85 g/mol. Its IUPAC name is tert-butyl N-[2-[(3-chloro-1H-indol-2-yl)methylamino]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[(3-chloro-1H-indol-2-yl)methylamino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 107245125 |
| Molecular Formula | C17H24ClN3O2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | tert-butyl N-[2-[(3-chloro-1H-indol-2-yl)methylamino]ethyl]-N-methylcarbamate |
| SMILES | CN(CCNCc1[nH]c2ccccc2c1Cl)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H24ClN3O2/c1-17(2,3)23-16(22)21(4)10-9-19-11-14-15(18)12-7-5-6-8-13(12)20-14/h5-8,19-20H,9-11H2,1-4H3 |
| InChIKey | DBBDERNZOVBZNB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|