C14H15ClN2 — CID 114159971
N-[(3-chloro-1H-indol-2-yl)methyl]pent-4-yn-1-amine (PubChem CID 114159971) has the molecular formula C14H15ClN2 and a molecular weight of 246.74 g/mol. Its IUPAC name is N-[(3-chloro-1H-indol-2-yl)methyl]pent-4-yn-1-amine.
| Compound Name | N-[(3-chloro-1H-indol-2-yl)methyl]pent-4-yn-1-amine |
|---|---|
| PubChem CID | 114159971 |
| Molecular Formula | C14H15ClN2 |
| Molecular Weight | 246.74 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | N-[(3-chloro-1H-indol-2-yl)methyl]pent-4-yn-1-amine |
| SMILES | C#CCCCNCc1[nH]c2ccccc2c1Cl |
| InChI | InChI=1S/C14H15ClN2/c1-2-3-6-9-16-10-13-14(15)11-7-4-5-8-12(11)17-13/h1,4-5,7-8,16-17H,3,6,9-10H2 |
| InChIKey | ZOGXUTJOXZJHMW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.74 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|