C19H22BrN — CID 81355085
3-(3-bromophenyl)-N-[(1S)-1-(2-methylphenyl)ethyl]cyclobutan-1-amine (PubChem CID 81355085) has the molecular formula C19H22BrN and a molecular weight of 344.30 g/mol. Its IUPAC name is 3-(3-bromophenyl)-N-[(1S)-1-(2-methylphenyl)ethyl]cyclobutan-1-amine.
| Compound Name | 3-(3-bromophenyl)-N-[(1S)-1-(2-methylphenyl)ethyl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 81355085 |
| Molecular Formula | C19H22BrN |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 3-(3-bromophenyl)-N-[(1S)-1-(2-methylphenyl)ethyl]cyclobutan-1-amine |
| SMILES | Cc1ccccc1[C@H](C)NC1CC(c2cccc(Br)c2)C1 |
| InChI | InChI=1S/C19H22BrN/c1-13-6-3-4-9-19(13)14(2)21-18-11-16(12-18)15-7-5-8-17(20)10-15/h3-10,14,16,18,21H,11-12H2,1-2H3/t14-,16?,18?/m0/s1 |
| InChIKey | CSQDVUYIEIFBJS-NXVRBGIVSA-N |
| XLogP | 5.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |