C13H21BrN2O — CID 81360198
1-[[(1R)-1-(4-bromophenyl)ethyl]amino]-3-(dimethylamino)propan-2-ol (PubChem CID 81360198) has the molecular formula C13H21BrN2O and a molecular weight of 301.23 g/mol. Its IUPAC name is 1-[[(1R)-1-(4-bromophenyl)ethyl]amino]-3-(dimethylamino)propan-2-ol.
| Compound Name | 1-[[(1R)-1-(4-bromophenyl)ethyl]amino]-3-(dimethylamino)propan-2-ol |
|---|---|
| PubChem CID | 81360198 |
| Molecular Formula | C13H21BrN2O |
| Molecular Weight | 301.23 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 1-[[(1R)-1-(4-bromophenyl)ethyl]amino]-3-(dimethylamino)propan-2-ol |
| SMILES | C[C@@H](NCC(O)CN(C)C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H21BrN2O/c1-10(11-4-6-12(14)7-5-11)15-8-13(17)9-16(2)3/h4-7,10,13,15,17H,8-9H2,1-3H3/t10-,13?/m1/s1 |
| InChIKey | POBJBBRVNDNYTN-VUUHIHSGSA-N |
| XLogP | 2.02 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.23 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |