C16H21Cl2N3 — CID 81362461
(1R)-N-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-1-(3-chlorophenyl)ethanamine (PubChem CID 81362461) has the molecular formula C16H21Cl2N3 and a molecular weight of 326.27 g/mol. Its IUPAC name is (1R)-N-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-1-(3-chlorophenyl)ethanamine.
| Compound Name | (1R)-N-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-1-(3-chlorophenyl)ethanamine |
|---|---|
| PubChem CID | 81362461 |
| Molecular Formula | C16H21Cl2N3 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | (1R)-N-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-1-(3-chlorophenyl)ethanamine |
| SMILES | CCCCc1nc(Cl)c(CN[C@H](C)c2cccc(Cl)c2)[nH]1 |
| InChI | InChI=1S/C16H21Cl2N3/c1-3-4-8-15-20-14(16(18)21-15)10-19-11(2)12-6-5-7-13(17)9-12/h5-7,9,11,19H,3-4,8,10H2,1-2H3,(H,20,21)/t11-/m1/s1 |
| InChIKey | QNDRRDBPNAGMRI-LLVKDONJSA-N |
| XLogP | 4.91 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |