C13H18ClN — CID 81377860
(1R)-1-(2-chlorophenyl)-N-(cyclobutylmethyl)ethanamine (PubChem CID 81377860) has the molecular formula C13H18ClN and a molecular weight of 223.75 g/mol. Its IUPAC name is (1R)-1-(2-chlorophenyl)-N-(cyclobutylmethyl)ethanamine.
| Compound Name | (1R)-1-(2-chlorophenyl)-N-(cyclobutylmethyl)ethanamine |
|---|---|
| PubChem CID | 81377860 |
| Molecular Formula | C13H18ClN |
| Molecular Weight | 223.75 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | (1R)-1-(2-chlorophenyl)-N-(cyclobutylmethyl)ethanamine |
| SMILES | C[C@@H](NCC1CCC1)c1ccccc1Cl |
| InChI | InChI=1S/C13H18ClN/c1-10(15-9-11-5-4-6-11)12-7-2-3-8-13(12)14/h2-3,7-8,10-11,15H,4-6,9H2,1H3/t10-/m1/s1 |
| InChIKey | OIUSHUSVGBQMDM-SNVBAGLBSA-N |
| XLogP | 3.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.75 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |