C14H20ClNO — CID 93447506
(1S)-1-(2-chlorophenyl)-N-[[(3R)-oxan-3-yl]methyl]ethanamine (PubChem CID 93447506) has the molecular formula C14H20ClNO and a molecular weight of 253.77 g/mol. Its IUPAC name is (1S)-1-(2-chlorophenyl)-N-[[(3R)-oxan-3-yl]methyl]ethanamine.
| Compound Name | (1S)-1-(2-chlorophenyl)-N-[[(3R)-oxan-3-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 93447506 |
| Molecular Formula | C14H20ClNO |
| Molecular Weight | 253.77 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | (1S)-1-(2-chlorophenyl)-N-[[(3R)-oxan-3-yl]methyl]ethanamine |
| SMILES | C[C@H](NC[C@H]1CCCOC1)c1ccccc1Cl |
| InChI | InChI=1S/C14H20ClNO/c1-11(13-6-2-3-7-14(13)15)16-9-12-5-4-8-17-10-12/h2-3,6-7,11-12,16H,4-5,8-10H2,1H3/t11-,12+/m0/s1 |
| InChIKey | PNPBDHFNNWNTJN-NWDGAFQWSA-N |
| XLogP | 3.42 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.77 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |