C12H15BrN4 — CID 81381613
(1S)-1-(3-bromophenyl)-N-[(1-methyltriazol-4-yl)methyl]ethanamine (PubChem CID 81381613) has the molecular formula C12H15BrN4 and a molecular weight of 295.18 g/mol. Its IUPAC name is (1S)-1-(3-bromophenyl)-N-[(1-methyltriazol-4-yl)methyl]ethanamine.
| Compound Name | (1S)-1-(3-bromophenyl)-N-[(1-methyltriazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 81381613 |
| Molecular Formula | C12H15BrN4 |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | (1S)-1-(3-bromophenyl)-N-[(1-methyltriazol-4-yl)methyl]ethanamine |
| SMILES | C[C@H](NCc1cn(C)nn1)c1cccc(Br)c1 |
| InChI | InChI=1S/C12H15BrN4/c1-9(10-4-3-5-11(13)6-10)14-7-12-8-17(2)16-15-12/h3-6,8-9,14H,7H2,1-2H3/t9-/m0/s1 |
| InChIKey | YLPAQWHMFBHLNE-VIFPVBQESA-N |
| XLogP | 2.43 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |