C13H18N4S — CID 62756861
1-(4-methylsulfanylphenyl)-N-[(1-methyltriazol-4-yl)methyl]ethanamine (PubChem CID 62756861) has the molecular formula C13H18N4S and a molecular weight of 262.38 g/mol. Its IUPAC name is 1-(4-methylsulfanylphenyl)-N-[(1-methyltriazol-4-yl)methyl]ethanamine.
| Compound Name | 1-(4-methylsulfanylphenyl)-N-[(1-methyltriazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 62756861 |
| Molecular Formula | C13H18N4S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 1-(4-methylsulfanylphenyl)-N-[(1-methyltriazol-4-yl)methyl]ethanamine |
| SMILES | CSc1ccc(C(C)NCc2cn(C)nn2)cc1 |
| InChI | InChI=1S/C13H18N4S/c1-10(11-4-6-13(18-3)7-5-11)14-8-12-9-17(2)16-15-12/h4-7,9-10,14H,8H2,1-3H3 |
| InChIKey | DFHGHOSJVDMTAU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |