C16H24BrN — CID 81383167
N-[(1S)-1-(2-bromophenyl)ethyl]-4-methylcycloheptan-1-amine (PubChem CID 81383167) has the molecular formula C16H24BrN and a molecular weight of 310.28 g/mol. Its IUPAC name is N-[(1S)-1-(2-bromophenyl)ethyl]-4-methylcycloheptan-1-amine.
| Compound Name | N-[(1S)-1-(2-bromophenyl)ethyl]-4-methylcycloheptan-1-amine |
|---|---|
| PubChem CID | 81383167 |
| Molecular Formula | C16H24BrN |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | N-[(1S)-1-(2-bromophenyl)ethyl]-4-methylcycloheptan-1-amine |
| SMILES | CC1CCCC(N[C@@H](C)c2ccccc2Br)CC1 |
| InChI | InChI=1S/C16H24BrN/c1-12-6-5-7-14(11-10-12)18-13(2)15-8-3-4-9-16(15)17/h3-4,8-9,12-14,18H,5-7,10-11H2,1-2H3/t12?,13-,14?/m0/s1 |
| InChIKey | IWFSUXIYWIJJJT-MOKVOYLWSA-N |
| XLogP | 5.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |