C17H24BrN — CID 81379091
N-[(1R)-1-(2-bromophenyl)ethyl]-3-cyclopropylcyclohexan-1-amine (PubChem CID 81379091) has the molecular formula C17H24BrN and a molecular weight of 322.29 g/mol. Its IUPAC name is N-[(1R)-1-(2-bromophenyl)ethyl]-3-cyclopropylcyclohexan-1-amine.
| Compound Name | N-[(1R)-1-(2-bromophenyl)ethyl]-3-cyclopropylcyclohexan-1-amine |
|---|---|
| PubChem CID | 81379091 |
| Molecular Formula | C17H24BrN |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | N-[(1R)-1-(2-bromophenyl)ethyl]-3-cyclopropylcyclohexan-1-amine |
| SMILES | C[C@@H](NC1CCCC(C2CC2)C1)c1ccccc1Br |
| InChI | InChI=1S/C17H24BrN/c1-12(16-7-2-3-8-17(16)18)19-15-6-4-5-14(11-15)13-9-10-13/h2-3,7-8,12-15,19H,4-6,9-11H2,1H3/t12-,14?,15?/m1/s1 |
| InChIKey | BRROWAJLZKYPLK-LRVUVFPRSA-N |
| XLogP | 5.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |