C15H22BrN — CID 103562170
N-[(1R)-1-(2-bromophenyl)ethyl]-3-propan-2-ylcyclobutan-1-amine (PubChem CID 103562170) has the molecular formula C15H22BrN and a molecular weight of 296.25 g/mol. Its IUPAC name is N-[(1R)-1-(2-bromophenyl)ethyl]-3-propan-2-ylcyclobutan-1-amine.
| Compound Name | N-[(1R)-1-(2-bromophenyl)ethyl]-3-propan-2-ylcyclobutan-1-amine |
|---|---|
| PubChem CID | 103562170 |
| Molecular Formula | C15H22BrN |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | N-[(1R)-1-(2-bromophenyl)ethyl]-3-propan-2-ylcyclobutan-1-amine |
| SMILES | CC(C)C1CC(N[C@H](C)c2ccccc2Br)C1 |
| InChI | InChI=1S/C15H22BrN/c1-10(2)12-8-13(9-12)17-11(3)14-6-4-5-7-15(14)16/h4-7,10-13,17H,8-9H2,1-3H3/t11-,12?,13?/m1/s1 |
| InChIKey | MPVDALQASKMIJT-PNESKVBLSA-N |
| XLogP | 4.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |