C16H29NO2 — CID 81387414
N-[(1S)-1-cyclohexylethyl]-1,4-dioxaspiro[4.5]decan-8-amine (PubChem CID 81387414) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is N-[(1S)-1-cyclohexylethyl]-1,4-dioxaspiro[4.5]decan-8-amine.
| Compound Name | N-[(1S)-1-cyclohexylethyl]-1,4-dioxaspiro[4.5]decan-8-amine |
|---|---|
| PubChem CID | 81387414 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | N-[(1S)-1-cyclohexylethyl]-1,4-dioxaspiro[4.5]decan-8-amine |
| SMILES | C[C@H](NC1CCC2(CC1)OCCO2)C1CCCCC1 |
| InChI | InChI=1S/C16H29NO2/c1-13(14-5-3-2-4-6-14)17-15-7-9-16(10-8-15)18-11-12-19-16/h13-15,17H,2-12H2,1H3/t13-/m0/s1 |
| InChIKey | FKQGIGMJPYTZHN-ZDUSSCGKSA-N |
| XLogP | 3.23 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |