C17H31NO2 — CID 81390369
N-[(1R)-1-cycloheptylethyl]-1,4-dioxaspiro[4.5]decan-8-amine (PubChem CID 81390369) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is N-[(1R)-1-cycloheptylethyl]-1,4-dioxaspiro[4.5]decan-8-amine.
| Compound Name | N-[(1R)-1-cycloheptylethyl]-1,4-dioxaspiro[4.5]decan-8-amine |
|---|---|
| PubChem CID | 81390369 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | N-[(1R)-1-cycloheptylethyl]-1,4-dioxaspiro[4.5]decan-8-amine |
| SMILES | C[C@@H](NC1CCC2(CC1)OCCO2)C1CCCCCC1 |
| InChI | InChI=1S/C17H31NO2/c1-14(15-6-4-2-3-5-7-15)18-16-8-10-17(11-9-16)19-12-13-20-17/h14-16,18H,2-13H2,1H3/t14-/m1/s1 |
| InChIKey | APYFSIOGKXDCRC-CQSZACIVSA-N |
| XLogP | 3.62 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |