C12H19N3OS — CID 81408624
N'-hydroxy-2-[1-[[[(1R)-1-thiophen-2-ylethyl]amino]methyl]cyclopropyl]ethanimidamide (PubChem CID 81408624) has the molecular formula C12H19N3OS and a molecular weight of 253.37 g/mol. Its IUPAC name is N'-hydroxy-2-[1-[[[(1R)-1-thiophen-2-ylethyl]amino]methyl]cyclopropyl]ethanimidamide.
| Compound Name | N'-hydroxy-2-[1-[[[(1R)-1-thiophen-2-ylethyl]amino]methyl]cyclopropyl]ethanimidamide |
|---|---|
| PubChem CID | 81408624 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | N'-hydroxy-2-[1-[[[(1R)-1-thiophen-2-ylethyl]amino]methyl]cyclopropyl]ethanimidamide |
| SMILES | C[C@@H](NCC1(C/C(N)=N/O)CC1)c1cccs1 |
| InChI | InChI=1S/C12H19N3OS/c1-9(10-3-2-6-17-10)14-8-12(4-5-12)7-11(13)15-16/h2-3,6,9,14,16H,4-5,7-8H2,1H3,(H2,13,15)/t9-/m1/s1 |
| InChIKey | QACFVKJSOQRLII-SECBINFHSA-N |
| XLogP | 2.32 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|