C14H23NO3S — CID 81412818
2-methyl-2-[(2-methyl-5-methylsulfonylanilino)methyl]butan-1-ol (PubChem CID 81412818) has the molecular formula C14H23NO3S and a molecular weight of 285.41 g/mol. Its IUPAC name is 2-methyl-2-[(2-methyl-5-methylsulfonylanilino)methyl]butan-1-ol.
| Compound Name | 2-methyl-2-[(2-methyl-5-methylsulfonylanilino)methyl]butan-1-ol |
|---|---|
| PubChem CID | 81412818 |
| Molecular Formula | C14H23NO3S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 2-methyl-2-[(2-methyl-5-methylsulfonylanilino)methyl]butan-1-ol |
| SMILES | CCC(C)(CO)CNc1cc(S(C)(=O)=O)ccc1C |
| InChI | InChI=1S/C14H23NO3S/c1-5-14(3,10-16)9-15-13-8-12(19(4,17)18)7-6-11(13)2/h6-8,15-16H,5,9-10H2,1-4H3 |
| InChIKey | GOONSHUCYJTCBJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |