C10H13BrOS — CID 81416200
3-(5-bromothiophen-2-yl)-2-ethylcyclobutan-1-ol (PubChem CID 81416200) has the molecular formula C10H13BrOS and a molecular weight of 261.18 g/mol. Its IUPAC name is 3-(5-bromothiophen-2-yl)-2-ethylcyclobutan-1-ol.
| Compound Name | 3-(5-bromothiophen-2-yl)-2-ethylcyclobutan-1-ol |
|---|---|
| PubChem CID | 81416200 |
| Molecular Formula | C10H13BrOS |
| Molecular Weight | 261.18 g/mol |
| Exact Mass | 259.99 |
| IUPAC Name | 3-(5-bromothiophen-2-yl)-2-ethylcyclobutan-1-ol |
| SMILES | CCC1C(O)CC1c1ccc(Br)s1 |
| InChI | InChI=1S/C10H13BrOS/c1-2-6-7(5-8(6)12)9-3-4-10(11)13-9/h3-4,6-8,12H,2,5H2,1H3 |
| InChIKey | FPWNOWXUGITALV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.18 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |