C13H21N3 — CID 81417531
N,2-diethyl-2-methyl-3-pyrazin-2-ylcyclobutan-1-amine (PubChem CID 81417531) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is N,2-diethyl-2-methyl-3-pyrazin-2-ylcyclobutan-1-amine.
| Compound Name | N,2-diethyl-2-methyl-3-pyrazin-2-ylcyclobutan-1-amine |
|---|---|
| PubChem CID | 81417531 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | N,2-diethyl-2-methyl-3-pyrazin-2-ylcyclobutan-1-amine |
| SMILES | CCNC1CC(c2cnccn2)C1(C)CC |
| InChI | InChI=1S/C13H21N3/c1-4-13(3)10(8-12(13)15-5-2)11-9-14-6-7-16-11/h6-7,9-10,12,15H,4-5,8H2,1-3H3 |
| InChIKey | AIWXQDKXLVDQRO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |