C12H15KN2O2 — CID 173406690
potassium;5,5-dimethyl-2-pyrazin-2-ylcyclohexane-1,3-dione;hydride (PubChem CID 173406690) has the molecular formula C12H15KN2O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is potassium;5,5-dimethyl-2-pyrazin-2-ylcyclohexane-1,3-dione;hydride.
| Compound Name | potassium;5,5-dimethyl-2-pyrazin-2-ylcyclohexane-1,3-dione;hydride |
|---|---|
| PubChem CID | 173406690 |
| Molecular Formula | C12H15KN2O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | potassium;5,5-dimethyl-2-pyrazin-2-ylcyclohexane-1,3-dione;hydride |
| SMILES | CC1(C)CC(=O)C(c2cnccn2)C(=O)C1.[H-].[K+] |
| InChI | InChI=1S/C12H14N2O2.K.H/c1-12(2)5-9(15)11(10(16)6-12)8-7-13-3-4-14-8;;/h3-4,7,11H,5-6H2,1-2H3;;/q;+1;-1 |
| InChIKey | ZKVKZBZZAMSVQX-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|