C13H16NNaO2 — CID 173406675
sodium;5,5-dimethyl-2-pyridin-2-ylcyclohexane-1,3-dione;hydride (PubChem CID 173406675) has the molecular formula C13H16NNaO2 and a molecular weight of 241.27 g/mol. Its IUPAC name is sodium;5,5-dimethyl-2-pyridin-2-ylcyclohexane-1,3-dione;hydride.
| Compound Name | sodium;5,5-dimethyl-2-pyridin-2-ylcyclohexane-1,3-dione;hydride |
|---|---|
| PubChem CID | 173406675 |
| Molecular Formula | C13H16NNaO2 |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | sodium;5,5-dimethyl-2-pyridin-2-ylcyclohexane-1,3-dione;hydride |
| SMILES | CC1(C)CC(=O)C(c2ccccn2)C(=O)C1.[H-].[Na+] |
| InChI | InChI=1S/C13H15NO2.Na.H/c1-13(2)7-10(15)12(11(16)8-13)9-5-3-4-6-14-9;;/h3-6,12H,7-8H2,1-2H3;;/q;+1;-1 |
| InChIKey | GDKQVXLLDQKCKN-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|