C22H28N4O — CID 136842700
(4S)-1-tert-butyl-3,7,7-trimethyl-4-pyridin-2-yl-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one (PubChem CID 136842700) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is (4S)-1-tert-butyl-3,7,7-trimethyl-4-pyridin-2-yl-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one.
| Compound Name | (4S)-1-tert-butyl-3,7,7-trimethyl-4-pyridin-2-yl-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one |
|---|---|
| PubChem CID | 136842700 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | (4S)-1-tert-butyl-3,7,7-trimethyl-4-pyridin-2-yl-4,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one |
| SMILES | Cc1nn(C(C)(C)C)c2c1[C@H](c1ccccn1)C1=C(CC(C)(C)CC1=O)N2 |
| InChI | InChI=1S/C22H28N4O/c1-13-17-19(14-9-7-8-10-23-14)18-15(11-22(5,6)12-16(18)27)24-20(17)26(25-13)21(2,3)4/h7-10,19,24H,11-12H2,1-6H3/t19-/m0/s1 |
| InChIKey | SHJHSQQHOKDVRY-IBGZPJMESA-N |
| XLogP | 4.54 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |