C16H21N5 — CID 81424586
N-[(2-pyrimidin-4-yl-5,6,7,8-tetrahydroquinazolin-6-yl)methyl]propan-1-amine (PubChem CID 81424586) has the molecular formula C16H21N5 and a molecular weight of 283.38 g/mol. Its IUPAC name is N-[(2-pyrimidin-4-yl-5,6,7,8-tetrahydroquinazolin-6-yl)methyl]propan-1-amine.
| Compound Name | N-[(2-pyrimidin-4-yl-5,6,7,8-tetrahydroquinazolin-6-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 81424586 |
| Molecular Formula | C16H21N5 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | N-[(2-pyrimidin-4-yl-5,6,7,8-tetrahydroquinazolin-6-yl)methyl]propan-1-amine |
| SMILES | CCCNCC1CCc2nc(-c3ccncn3)ncc2C1 |
| InChI | InChI=1S/C16H21N5/c1-2-6-17-9-12-3-4-14-13(8-12)10-19-16(21-14)15-5-7-18-11-20-15/h5,7,10-12,17H,2-4,6,8-9H2,1H3 |
| InChIKey | NWRVVERNHMQSAU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|