C14H25N3O4 — CID 81426190
ethyl (3R)-1-[2-(carbamoylamino)-3-methylbutanoyl]piperidine-3-carboxylate (PubChem CID 81426190) has the molecular formula C14H25N3O4 and a molecular weight of 299.37 g/mol. Its IUPAC name is ethyl (3R)-1-[2-(carbamoylamino)-3-methylbutanoyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[2-(carbamoylamino)-3-methylbutanoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 81426190 |
| Molecular Formula | C14H25N3O4 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | ethyl (3R)-1-[2-(carbamoylamino)-3-methylbutanoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(C(=O)C(NC(N)=O)C(C)C)C1 |
| InChI | InChI=1S/C14H25N3O4/c1-4-21-13(19)10-6-5-7-17(8-10)12(18)11(9(2)3)16-14(15)20/h9-11H,4-8H2,1-3H3,(H3,15,16,20)/t10-,11?/m1/s1 |
| InChIKey | ROEWIXGISSHPBG-NFJWQWPMSA-N |
| XLogP | 0.48 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |