C15H21ClFNO2S — CID 81427428
3-(chloromethyl)-N-(cyclopentylmethyl)-4-fluoro-N,5-dimethylbenzenesulfonamide (PubChem CID 81427428) has the molecular formula C15H21ClFNO2S and a molecular weight of 333.86 g/mol. Its IUPAC name is 3-(chloromethyl)-N-(cyclopentylmethyl)-4-fluoro-N,5-dimethylbenzenesulfonamide.
| Compound Name | 3-(chloromethyl)-N-(cyclopentylmethyl)-4-fluoro-N,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 81427428 |
| Molecular Formula | C15H21ClFNO2S |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 3-(chloromethyl)-N-(cyclopentylmethyl)-4-fluoro-N,5-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(C)CC2CCCC2)cc(CCl)c1F |
| InChI | InChI=1S/C15H21ClFNO2S/c1-11-7-14(8-13(9-16)15(11)17)21(19,20)18(2)10-12-5-3-4-6-12/h7-8,12H,3-6,9-10H2,1-2H3 |
| InChIKey | ZTJYVTAXFCELPA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|