C13H12N4S — CID 81427554
methyl N-cyano-N'-(quinolin-8-ylmethyl)carbamimidothioate (PubChem CID 81427554) has the molecular formula C13H12N4S and a molecular weight of 256.33 g/mol. Its IUPAC name is methyl N-cyano-N'-(quinolin-8-ylmethyl)carbamimidothioate.
| Compound Name | methyl N-cyano-N'-(quinolin-8-ylmethyl)carbamimidothioate |
|---|---|
| PubChem CID | 81427554 |
| Molecular Formula | C13H12N4S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | methyl N-cyano-N'-(quinolin-8-ylmethyl)carbamimidothioate |
| SMILES | CS/C(=N\Cc1cccc2cccnc12)NC#N |
| InChI | InChI=1S/C13H12N4S/c1-18-13(17-9-14)16-8-11-5-2-4-10-6-3-7-15-12(10)11/h2-7H,8H2,1H3,(H,16,17) |
| InChIKey | IEWNLSQOUQPOFV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 61.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|