C14H27ClN2 — CID 81430248
N-[(E)-4-chlorobut-2-enyl]-N'-cyclohexyl-N'-methylpropane-1,3-diamine (PubChem CID 81430248) has the molecular formula C14H27ClN2 and a molecular weight of 258.84 g/mol. Its IUPAC name is N-[(E)-4-chlorobut-2-enyl]-N'-cyclohexyl-N'-methylpropane-1,3-diamine.
| Compound Name | N-[(E)-4-chlorobut-2-enyl]-N'-cyclohexyl-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 81430248 |
| Molecular Formula | C14H27ClN2 |
| Molecular Weight | 258.84 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | N-[(E)-4-chlorobut-2-enyl]-N'-cyclohexyl-N'-methylpropane-1,3-diamine |
| SMILES | CN(CCCNC/C=C/CCl)C1CCCCC1 |
| InChI | InChI=1S/C14H27ClN2/c1-17(14-8-3-2-4-9-14)13-7-12-16-11-6-5-10-15/h5-6,14,16H,2-4,7-13H2,1H3/b6-5+ |
| InChIKey | JRJWBUMTNRHGFD-AATRIKPKSA-N |
| XLogP | 3.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.84 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|