C12H14FNO4S — CID 81434882
5-[cyclopropyl(methyl)sulfamoyl]-2-fluoro-3-methylbenzoic acid (PubChem CID 81434882) has the molecular formula C12H14FNO4S and a molecular weight of 287.31 g/mol. Its IUPAC name is 5-[cyclopropyl(methyl)sulfamoyl]-2-fluoro-3-methylbenzoic acid.
| Compound Name | 5-[cyclopropyl(methyl)sulfamoyl]-2-fluoro-3-methylbenzoic acid |
|---|---|
| PubChem CID | 81434882 |
| Molecular Formula | C12H14FNO4S |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 5-[cyclopropyl(methyl)sulfamoyl]-2-fluoro-3-methylbenzoic acid |
| SMILES | Cc1cc(S(=O)(=O)N(C)C2CC2)cc(C(=O)O)c1F |
| InChI | InChI=1S/C12H14FNO4S/c1-7-5-9(6-10(11(7)13)12(15)16)19(17,18)14(2)8-3-4-8/h5-6,8H,3-4H2,1-2H3,(H,15,16) |
| InChIKey | RMUJFRYDUQHFPE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |