C12H14FNO5S — CID 107215642
2-fluoro-5-(3-hydroxy-3-methylazetidin-1-yl)sulfonyl-3-methylbenzoic acid (PubChem CID 107215642) has the molecular formula C12H14FNO5S and a molecular weight of 303.31 g/mol. Its IUPAC name is 2-fluoro-5-(3-hydroxy-3-methylazetidin-1-yl)sulfonyl-3-methylbenzoic acid.
| Compound Name | 2-fluoro-5-(3-hydroxy-3-methylazetidin-1-yl)sulfonyl-3-methylbenzoic acid |
|---|---|
| PubChem CID | 107215642 |
| Molecular Formula | C12H14FNO5S |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 2-fluoro-5-(3-hydroxy-3-methylazetidin-1-yl)sulfonyl-3-methylbenzoic acid |
| SMILES | Cc1cc(S(=O)(=O)N2CC(C)(O)C2)cc(C(=O)O)c1F |
| InChI | InChI=1S/C12H14FNO5S/c1-7-3-8(4-9(10(7)13)11(15)16)20(18,19)14-5-12(2,17)6-14/h3-4,17H,5-6H2,1-2H3,(H,15,16) |
| InChIKey | VTQWELATEJSOTD-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |