C13H17FN2O4S — CID 81426509
5-(1,4-diazepan-1-ylsulfonyl)-2-fluoro-3-methylbenzoic acid (PubChem CID 81426509) has the molecular formula C13H17FN2O4S and a molecular weight of 316.35 g/mol. Its IUPAC name is 5-(1,4-diazepan-1-ylsulfonyl)-2-fluoro-3-methylbenzoic acid.
| Compound Name | 5-(1,4-diazepan-1-ylsulfonyl)-2-fluoro-3-methylbenzoic acid |
|---|---|
| PubChem CID | 81426509 |
| Molecular Formula | C13H17FN2O4S |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 5-(1,4-diazepan-1-ylsulfonyl)-2-fluoro-3-methylbenzoic acid |
| SMILES | Cc1cc(S(=O)(=O)N2CCCNCC2)cc(C(=O)O)c1F |
| InChI | InChI=1S/C13H17FN2O4S/c1-9-7-10(8-11(12(9)14)13(17)18)21(19,20)16-5-2-3-15-4-6-16/h7-8,15H,2-6H2,1H3,(H,17,18) |
| InChIKey | PTRQMGFEDMHJKR-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |