C14H22ClN3O4S — CID 154907802
5-(1,4-diazepan-1-ylsulfonyl)-2-methoxy-N-methylbenzamide;hydrochloride (PubChem CID 154907802) has the molecular formula C14H22ClN3O4S and a molecular weight of 363.87 g/mol. Its IUPAC name is 5-(1,4-diazepan-1-ylsulfonyl)-2-methoxy-N-methylbenzamide;hydrochloride.
| Compound Name | 5-(1,4-diazepan-1-ylsulfonyl)-2-methoxy-N-methylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 154907802 |
| Molecular Formula | C14H22ClN3O4S |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 5-(1,4-diazepan-1-ylsulfonyl)-2-methoxy-N-methylbenzamide;hydrochloride |
| SMILES | CNC(=O)c1cc(S(=O)(=O)N2CCCNCC2)ccc1OC.Cl |
| InChI | InChI=1S/C14H21N3O4S.ClH/c1-15-14(18)12-10-11(4-5-13(12)21-2)22(19,20)17-8-3-6-16-7-9-17;/h4-5,10,16H,3,6-9H2,1-2H3,(H,15,18);1H |
| InChIKey | KIDWVGHARQLSIT-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |