C11H11ClFNO5S — CID 107215635
5-chloro-2-fluoro-3-(3-hydroxy-3-methylazetidin-1-yl)sulfonylbenzoic acid (PubChem CID 107215635) has the molecular formula C11H11ClFNO5S and a molecular weight of 323.73 g/mol. Its IUPAC name is 5-chloro-2-fluoro-3-(3-hydroxy-3-methylazetidin-1-yl)sulfonylbenzoic acid.
| Compound Name | 5-chloro-2-fluoro-3-(3-hydroxy-3-methylazetidin-1-yl)sulfonylbenzoic acid |
|---|---|
| PubChem CID | 107215635 |
| Molecular Formula | C11H11ClFNO5S |
| Molecular Weight | 323.73 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | 5-chloro-2-fluoro-3-(3-hydroxy-3-methylazetidin-1-yl)sulfonylbenzoic acid |
| SMILES | CC1(O)CN(S(=O)(=O)c2cc(Cl)cc(C(=O)O)c2F)C1 |
| InChI | InChI=1S/C11H11ClFNO5S/c1-11(17)4-14(5-11)20(18,19)8-3-6(12)2-7(9(8)13)10(15)16/h2-3,17H,4-5H2,1H3,(H,15,16) |
| InChIKey | OHBITKNIEXOJSM-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.73 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |